C21H23NO3 — CID 98474902
(4R,4aR,7aS,12bR)-3-(furan-3-ylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 98474902) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (4R,4aR,7aS,12bR)-3-(furan-3-ylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4R,4aR,7aS,12bR)-3-(furan-3-ylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 98474902 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (4R,4aR,7aS,12bR)-3-(furan-3-ylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | Oc1ccc2c3c1O[C@H]1CCC[C@H]4[C@@H](C2)N(Cc2ccoc2)CC[C@@]314 |
| InChI | InChI=1S/C21H23NO3/c23-17-5-4-14-10-16-15-2-1-3-18-21(15,19(14)20(17)25-18)7-8-22(16)11-13-6-9-24-12-13/h4-6,9,12,15-16,18,23H,1-3,7-8,10-11H2/t15-,16+,18-,21-/m0/s1 |
| InChIKey | QJTYWRUTNAJPQP-HPNQWNLUSA-N |
| XLogP | 3.61 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |