C23H31NO3 — CID 57073741
(4R,4aR,7S,7aR,12bS)-3-[(2-ethylcyclopropyl)methyl]-7-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 57073741) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-[(2-ethylcyclopropyl)methyl]-7-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-[(2-ethylcyclopropyl)methyl]-7-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 57073741 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-[(2-ethylcyclopropyl)methyl]-7-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | CCC1CC1CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@](C)(O)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H31NO3/c1-3-13-10-15(13)12-24-9-8-23-16-6-7-22(2,26)21(23)27-20-18(25)5-4-14(19(20)23)11-17(16)24/h4-5,13,15-17,21,25-26H,3,6-12H2,1-2H3/t13?,15?,16-,17+,21-,22-,23-/m0/s1 |
| InChIKey | OAQAXHNTWRVUIC-LIINYESMSA-N |
| XLogP | 3.23 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |