C22H29NO2 — CID 162098187
(4S,7aR,12bR)-3-butyl-7,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 162098187) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (4S,7aR,12bR)-3-butyl-7,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4S,7aR,12bR)-3-butyl-7,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 162098187 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (4S,7aR,12bR)-3-butyl-7,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | CCCCN1CC[C@@]23c4c5ccc(O)c4O[C@@H]2C(C)(C)C=CC3[C@@H]1C5 |
| InChI | InChI=1S/C22H29NO2/c1-4-5-11-23-12-10-22-15-8-9-21(2,3)20(22)25-19-17(24)7-6-14(18(19)22)13-16(15)23/h6-9,15-16,20,24H,4-5,10-13H2,1-3H3/t15?,16-,20+,22+/m0/s1 |
| InChIKey | FSVXIEFZAXXZGF-SKIZLPJYSA-N |
| XLogP | 4.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|