C23H29NO4 — CID 22816306
(4R,4aR,5S,7aR,12bS)-5-ethyl-9-hydroxy-3-(oxolan-2-ylmethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 22816306) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (4R,4aR,5S,7aR,12bS)-5-ethyl-9-hydroxy-3-(oxolan-2-ylmethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,5S,7aR,12bS)-5-ethyl-9-hydroxy-3-(oxolan-2-ylmethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 22816306 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (4R,4aR,5S,7aR,12bS)-5-ethyl-9-hydroxy-3-(oxolan-2-ylmethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CC[C@H]1CC(=O)[C@@H]2Oc3c(O)ccc4c3[C@@]23CCN(CC2CCCO2)[C@H](C4)[C@H]13 |
| InChI | InChI=1S/C23H29NO4/c1-2-13-11-18(26)22-23-7-8-24(12-15-4-3-9-27-15)16(19(13)23)10-14-5-6-17(25)21(28-22)20(14)23/h5-6,13,15-16,19,22,25H,2-4,7-12H2,1H3/t13-,15?,16+,19-,22-,23-/m0/s1 |
| InChIKey | PYFAWQLYUCDOAN-VAYDWVRZSA-N |
| XLogP | 2.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |