C19H28N2O — CID 10990244
(1R,9R,13R)-1,13-dimethyl-10-[[(2S)-oxolan-2-yl]methyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine (PubChem CID 10990244) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (1R,9R,13R)-1,13-dimethyl-10-[[(2S)-oxolan-2-yl]methyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,13R)-1,13-dimethyl-10-[[(2S)-oxolan-2-yl]methyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 10990244 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (1R,9R,13R)-1,13-dimethyl-10-[[(2S)-oxolan-2-yl]methyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
| SMILES | C[C@H]1[C@H]2Cc3ccc(N)cc3[C@]1(C)CCN2C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H28N2O/c1-13-18-10-14-5-6-15(20)11-17(14)19(13,2)7-8-21(18)12-16-4-3-9-22-16/h5-6,11,13,16,18H,3-4,7-10,12,20H2,1-2H3/t13-,16-,18+,19+/m0/s1 |
| InChIKey | LVZWQSSWZVLAGU-PTKHLAPESA-N |
| XLogP | 2.97 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|