C18H27N3 — CID 59334291
(1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4,5-diamine (PubChem CID 59334291) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4,5-diamine.
| Compound Name | (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4,5-diamine |
|---|---|
| PubChem CID | 59334291 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4,5-diamine |
| SMILES | C[C@H]1C2Cc3cc(N)c(N)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C18H27N3/c1-11-17-8-13-7-15(19)16(20)9-14(13)18(11,2)5-6-21(17)10-12-3-4-12/h7,9,11-12,17H,3-6,8,10,19-20H2,1-2H3/t11-,17?,18-/m0/s1 |
| InChIKey | UAIWUSDXBKZQDM-ABRORHJPSA-N |
| XLogP | 2.79 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|