C26H34N2 — CID 101000893
(1S,9S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine (PubChem CID 101000893) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (1S,9S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine.
| Compound Name | (1S,9S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 101000893 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (1S,9S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
| SMILES | C[C@@H]1[C@@H]2Cc3ccc(NCCc4ccccc4)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C26H34N2/c1-19-25-16-22-10-11-23(27-14-12-20-6-4-3-5-7-20)17-24(22)26(19,2)13-15-28(25)18-21-8-9-21/h3-7,10-11,17,19,21,25,27H,8-9,12-16,18H2,1-2H3/t19-,25+,26+/m1/s1 |
| InChIKey | CBEQNEFYEBRKMD-PBXQCXKZSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |