C31H37N3O — CID 130287805
(1S,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(1H-pyrrol-3-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 130287805) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is (1S,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(1H-pyrrol-3-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(1H-pyrrol-3-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 130287805 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (1S,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(1H-pyrrol-3-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | C[C@H]1[C@H]2Cc3ccc(C(=O)NCCc4ccc(-c5cc[nH]c5)cc4)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C31H37N3O/c1-21-29-18-25-9-10-26(17-28(25)31(21,2)13-16-34(29)20-23-3-4-23)30(35)33-15-11-22-5-7-24(8-6-22)27-12-14-32-19-27/h5-10,12,14,17,19,21,23,29,32H,3-4,11,13,15-16,18,20H2,1-2H3,(H,33,35)/t21-,29+,31-/m0/s1 |
| InChIKey | KQKRIDSVFMWIAV-ASVQBKGPSA-N |
| XLogP | 5.59 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |