C31H37N3O — CID 157309645
(1R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(2H-pyrrol-4-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 157309645) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is (1R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(2H-pyrrol-4-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(2H-pyrrol-4-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 157309645 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (1R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-(2H-pyrrol-4-yl)phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | CC1C2Cc3ccc(C(=O)NCCc4ccc(C5=CCN=C5)cc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C31H37N3O/c1-21-29-18-25-9-10-26(17-28(25)31(21,2)13-16-34(29)20-23-3-4-23)30(35)33-15-11-22-5-7-24(8-6-22)27-12-14-32-19-27/h5-10,12,17,19,21,23,29H,3-4,11,13-16,18,20H2,1-2H3,(H,33,35)/t21?,29?,31-/m1/s1 |
| InChIKey | CBBFQCBGCRYDBW-RDJIPZCZSA-N |
| XLogP | 5.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |