C33H38N2O — CID 67415236
(1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(2-phenylphenyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 67415236) has the molecular formula C33H38N2O and a molecular weight of 478.68 g/mol. Its IUPAC name is (1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(2-phenylphenyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(2-phenylphenyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 67415236 |
| Molecular Formula | C33H38N2O |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | (1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(2-phenylphenyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | C[C@@H]1[C@H]2Cc3ccc(C(=O)NCCc4ccccc4-c4ccccc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C33H38N2O/c1-23-31-21-27-14-15-28(20-30(27)33(23,2)17-19-35(31)22-24-12-13-24)32(36)34-18-16-26-10-6-7-11-29(26)25-8-4-3-5-9-25/h3-11,14-15,20,23-24,31H,12-13,16-19,21-22H2,1-2H3,(H,34,36)/t23-,31-,33-/m1/s1 |
| InChIKey | VHBQYOYZNDRQMW-FWZGMSPUSA-N |
| XLogP | 6.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |