C31H40N4O — CID 139326276
(1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 139326276) has the molecular formula C31H40N4O and a molecular weight of 484.69 g/mol. Its IUPAC name is (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 139326276 |
| Molecular Formula | C31H40N4O |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (1S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-[4-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]phenyl]ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | C=NN/C=C(\C)c1ccc(CCNC(=O)c2ccc3c(c2)[C@@]2(C)CCN(CC4CC4)C(C3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C31H40N4O/c1-21(19-34-32-4)25-9-7-23(8-10-25)13-15-33-30(36)27-12-11-26-18-29-22(2)31(3,28(26)17-27)14-16-35(29)20-24-5-6-24/h7-12,17,19,22,24,29,34H,4-6,13-16,18,20H2,1-3H3,(H,33,36)/b21-19+/t22-,29?,31-/m0/s1 |
| InChIKey | OTNSCIFVLFCGBA-DLLNXPCDSA-N |
| XLogP | 5.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|