C22H28N2O2S — CID 10452628
N-[(1S,9S,13S)-10-benzyl-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methanesulfonamide (PubChem CID 10452628) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-[(1S,9S,13S)-10-benzyl-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methanesulfonamide.
| Compound Name | N-[(1S,9S,13S)-10-benzyl-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10452628 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-[(1S,9S,13S)-10-benzyl-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methanesulfonamide |
| SMILES | C[C@@H]1[C@@H]2Cc3ccc(NS(C)(=O)=O)cc3[C@@]1(C)CCN2Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O2S/c1-16-21-13-18-9-10-19(23-27(3,25)26)14-20(18)22(16,2)11-12-24(21)15-17-7-5-4-6-8-17/h4-10,14,16,21,23H,11-13,15H2,1-3H3/t16-,21+,22+/m1/s1 |
| InChIKey | PBEYSGZDOQLDOT-XGRCMKMKSA-N |
| XLogP | 3.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |