About N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide
N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide (PubChem CID 23000924) has the molecular formula C22H30N2O2S
and a molecular weight of 386.56 g/mol. Its IUPAC name is N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide |
| PubChem CID | 23000924 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide |
| SMILES | CC1CN(CCc2ccccc2)CCC1(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H30N2O2S/c1-18-17-24(14-12-19-8-5-4-6-9-19)15-13-22(18,2)20-10-7-11-21(16-20)23-27(3,25)26/h4-11,16,18,23H,12-15,17H2,1-3H3 |
| InChIKey | MSKRDNFUROXRKN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide (CID 23000924) is N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide is CC1CN(CCc2ccccc2)CCC1(C)c1cccc(NS(C)(=O)=O)c1.
What is the InChIKey of N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide?
The InChIKey is MSKRDNFUROXRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O2S/c1-18-17-24(14-12-19-8-5-4-6-9-19)15-13-22(18,2)20-10-7-11-21(16-20)23-27(3,25)26/h4-11,16,18,23H,12-15,17H2,1-3H3.
What are the key properties of N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide?
N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide has a molecular weight of 386.56 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3,4-dimethyl-1-(2-phenylethyl)piperidin-4-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 23000924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).