About 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide
4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide (PubChem CID 70588688) has the molecular formula C21H28BrNO
and a molecular weight of 390.37 g/mol. Its IUPAC name is 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide.
Molecular Properties
| Compound Name | 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide |
| PubChem CID | 70588688 |
| Molecular Formula | C21H28BrNO |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide |
| SMILES | Br.C[C@H]1CN(CCc2ccc(O)cc2)CC[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C21H27NO.BrH/c1-17-16-22(14-12-18-8-10-20(23)11-9-18)15-13-21(17,2)19-6-4-3-5-7-19;/h3-11,17,23H,12-16H2,1-2H3;1H/t17-,21-;/m0./s1 |
| InChIKey | PIYFRLYZHFIXHY-PVMVIUQGSA-N |
| XLogP | 4.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide?
The IUPAC name of 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide (CID 70588688) is 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide.
What is the SMILES notation for 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide?
The canonical SMILES for 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide is Br.C[C@H]1CN(CCc2ccc(O)cc2)CC[C@]1(C)c1ccccc1.
What is the InChIKey of 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide?
The InChIKey is PIYFRLYZHFIXHY-PVMVIUQGSA-N. The full InChI is InChI=1S/C21H27NO.BrH/c1-17-16-22(14-12-18-8-10-20(23)11-9-18)15-13-21(17,2)19-6-4-3-5-7-19;/h3-11,17,23H,12-16H2,1-2H3;1H/t17-,21-;/m0./s1.
What are the key properties of 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide?
4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide has a molecular weight of 390.37 g/mol, XLogP of 4.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3R,4S)-3,4-dimethyl-4-phenylpiperidin-1-yl]ethyl]phenol;hydrobromide is sourced from PubChem (CID 70588688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).