C22H27NO — CID 70510265
(4aR,10bR)-10b-methyl-3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydrobenzo[f]isoquinolin-9-ol (PubChem CID 70510265) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (4aR,10bR)-10b-methyl-3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydrobenzo[f]isoquinolin-9-ol.
| Compound Name | (4aR,10bR)-10b-methyl-3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydrobenzo[f]isoquinolin-9-ol |
|---|---|
| PubChem CID | 70510265 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (4aR,10bR)-10b-methyl-3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydrobenzo[f]isoquinolin-9-ol |
| SMILES | C[C@@]12CCN(CCc3ccccc3)C[C@@H]1CCc1ccc(O)cc12 |
| InChI | InChI=1S/C22H27NO/c1-22-12-14-23(13-11-17-5-3-2-4-6-17)16-19(22)9-7-18-8-10-20(24)15-21(18)22/h2-6,8,10,15,19,24H,7,9,11-14,16H2,1H3/t19-,22+/m0/s1 |
| InChIKey | FJYDUPABACAKJJ-SIKLNZKXSA-N |
| XLogP | 4.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |