C22H27NO2 — CID 90679096
(1R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol (PubChem CID 90679096) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (1R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol.
| Compound Name | (1R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
|---|---|
| PubChem CID | 90679096 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (1R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
| SMILES | C[C@]1(O)C2Cc3ccc(O)cc3[C@@]1(C)CCN2CCc1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-21-11-13-23(12-10-16-6-4-3-5-7-16)20(22(21,2)25)14-17-8-9-18(24)15-19(17)21/h3-9,15,20,24-25H,10-14H2,1-2H3/t20?,21-,22+/m1/s1 |
| InChIKey | ODOJTGADBQHRJE-PDQYLBCOSA-N |
| XLogP | 3.27 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |