C15H21NO2 — CID 90679099
(1R,13R)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol (PubChem CID 90679099) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (1R,13R)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol.
| Compound Name | (1R,13R)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
|---|---|
| PubChem CID | 90679099 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (1R,13R)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3CC1[C@]2(C)O |
| InChI | InChI=1S/C15H21NO2/c1-14-6-7-16(3)13(15(14,2)18)8-10-4-5-11(17)9-12(10)14/h4-5,9,13,17-18H,6-8H2,1-3H3/t13?,14-,15+/m1/s1 |
| InChIKey | WOSDJPAOAUTBDI-DMJDIKPUSA-N |
| XLogP | 1.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |