C17H21NO4 — CID 91552066
(1R,9R,10S)-4,10,13-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one (PubChem CID 91552066) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1R,9R,10S)-4,10,13-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one.
| Compound Name | (1R,9R,10S)-4,10,13-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one |
|---|---|
| PubChem CID | 91552066 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1R,9R,10S)-4,10,13-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one |
| SMILES | CN1CC[C@]23C(=O)C(O)CC[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H21NO4/c1-18-7-6-16-12-9-11(19)3-2-10(12)8-14(18)17(16,22)5-4-13(20)15(16)21/h2-3,9,13-14,19-20,22H,4-8H2,1H3/t13?,14-,16+,17-/m1/s1 |
| InChIKey | GYKLXTMIJLGQTI-IIYZTLLPSA-N |
| XLogP | 0.35 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |