C18H22N2O4 — CID 121389032
(1R,3S,7S,9S,10R)-9,15-dihydroxy-20-methyl-4-oxa-6,20-diazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12(17),13,15-trien-5-one (PubChem CID 121389032) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1R,3S,7S,9S,10R)-9,15-dihydroxy-20-methyl-4-oxa-6,20-diazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12(17),13,15-trien-5-one.
| Compound Name | (1R,3S,7S,9S,10R)-9,15-dihydroxy-20-methyl-4-oxa-6,20-diazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12(17),13,15-trien-5-one |
|---|---|
| PubChem CID | 121389032 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (1R,3S,7S,9S,10R)-9,15-dihydroxy-20-methyl-4-oxa-6,20-diazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12(17),13,15-trien-5-one |
| SMILES | CN1CC[C@]23C[C@@H]4OC(=O)N[C@H]4C[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C18H22N2O4/c1-20-5-4-17-9-14-13(19-16(22)24-14)8-18(17,23)15(20)6-10-2-3-11(21)7-12(10)17/h2-3,7,13-15,21,23H,4-6,8-9H2,1H3,(H,19,22)/t13-,14-,15+,17+,18+/m0/s1 |
| InChIKey | IBDXDRVNGXCLNA-KCEFYPGHSA-N |
| XLogP | 0.89 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |