C24H26Cl2N2O3 — CID 122699192
(1S,9R,10S,12R)-N-[(2,4-dichlorophenyl)methyl]-4,10-dihydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide (PubChem CID 122699192) has the molecular formula C24H26Cl2N2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is (1S,9R,10S,12R)-N-[(2,4-dichlorophenyl)methyl]-4,10-dihydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R,10S,12R)-N-[(2,4-dichlorophenyl)methyl]-4,10-dihydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 122699192 |
| Molecular Formula | C24H26Cl2N2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (1S,9R,10S,12R)-N-[(2,4-dichlorophenyl)methyl]-4,10-dihydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
| SMILES | CN1CC[C@]23C[C@@H](C(=O)NCc4ccc(Cl)cc4Cl)C[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C24H26Cl2N2O3/c1-28-7-6-23-11-16(22(30)27-13-15-2-4-17(25)9-20(15)26)12-24(23,31)21(28)8-14-3-5-18(29)10-19(14)23/h2-5,9-10,16,21,29,31H,6-8,11-13H2,1H3,(H,27,30)/t16-,21-,23-,24-/m1/s1 |
| InChIKey | AKMIFRDHUZOURD-KMBRJESTSA-N |
| XLogP | 3.65 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |