C25H26Cl2N2O3 — CID 144877281
(12R,13S,15S)-N-[(2,4-dichlorophenyl)methyl]-4,13-dihydroxy-11-methyl-11-azapentacyclo[7.7.1.01,13.02,7.09,12]heptadeca-2(7),3,5-triene-15-carboxamide (PubChem CID 144877281) has the molecular formula C25H26Cl2N2O3 and a molecular weight of 473.40 g/mol. Its IUPAC name is (12R,13S,15S)-N-[(2,4-dichlorophenyl)methyl]-4,13-dihydroxy-11-methyl-11-azapentacyclo[7.7.1.01,13.02,7.09,12]heptadeca-2(7),3,5-triene-15-carboxamide.
| Compound Name | (12R,13S,15S)-N-[(2,4-dichlorophenyl)methyl]-4,13-dihydroxy-11-methyl-11-azapentacyclo[7.7.1.01,13.02,7.09,12]heptadeca-2(7),3,5-triene-15-carboxamide |
|---|---|
| PubChem CID | 144877281 |
| Molecular Formula | C25H26Cl2N2O3 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (12R,13S,15S)-N-[(2,4-dichlorophenyl)methyl]-4,13-dihydroxy-11-methyl-11-azapentacyclo[7.7.1.01,13.02,7.09,12]heptadeca-2(7),3,5-triene-15-carboxamide |
| SMILES | CN1CC23Cc4ccc(O)cc4C4(C[C@H](C(=O)NCc5ccc(Cl)cc5Cl)C[C@@]4(O)[C@H]12)C3 |
| InChI | InChI=1S/C25H26Cl2N2O3/c1-29-13-23-8-14-3-5-18(30)7-19(14)24(12-23)9-16(10-25(24,32)22(23)29)21(31)28-11-15-2-4-17(26)6-20(15)27/h2-7,16,22,30,32H,8-13H2,1H3,(H,28,31)/t16-,22+,23?,24?,25+/m0/s1 |
| InChIKey | OZIYIFDRPKUQGW-IAQJIANASA-N |
| XLogP | 3.65 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |