C27H31ClN2O3 — CID 122699245
(1S,9R,10S,12R)-N-[(3-chlorophenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide (PubChem CID 122699245) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is (1S,9R,10S,12R)-N-[(3-chlorophenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R,10S,12R)-N-[(3-chlorophenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 122699245 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (1S,9R,10S,12R)-N-[(3-chlorophenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)[C@@H]1C[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)[C@]3(O)C1 |
| InChI | InChI=1S/C27H31ClN2O3/c28-21-3-1-2-18(10-21)15-29-25(32)20-13-26-8-9-30(16-17-4-5-17)24(27(26,33)14-20)11-19-6-7-22(31)12-23(19)26/h1-3,6-7,10,12,17,20,24,31,33H,4-5,8-9,11,13-16H2,(H,29,32)/t20-,24-,26-,27-/m1/s1 |
| InChIKey | QAPIPMICRKNOKP-RXTZQXTGSA-N |
| XLogP | 3.78 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |