C27H31ClN2O4 — CID 122699158
(1S,9R,10S,12R)-N-[(3-chloro-4-hydroxyphenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide (PubChem CID 122699158) has the molecular formula C27H31ClN2O4 and a molecular weight of 483.01 g/mol. Its IUPAC name is (1S,9R,10S,12R)-N-[(3-chloro-4-hydroxyphenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R,10S,12R)-N-[(3-chloro-4-hydroxyphenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 122699158 |
| Molecular Formula | C27H31ClN2O4 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (1S,9R,10S,12R)-N-[(3-chloro-4-hydroxyphenyl)methyl]-16-(cyclopropylmethyl)-4,10-dihydroxy-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(NCc1ccc(O)c(Cl)c1)[C@@H]1C[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)[C@]3(O)C1 |
| InChI | InChI=1S/C27H31ClN2O4/c28-22-9-17(3-6-23(22)32)14-29-25(33)19-12-26-7-8-30(15-16-1-2-16)24(27(26,34)13-19)10-18-4-5-20(31)11-21(18)26/h3-6,9,11,16,19,24,31-32,34H,1-2,7-8,10,12-15H2,(H,29,33)/t19-,24-,26-,27-/m1/s1 |
| InChIKey | WYZGNJNCBPPHQB-XVRHYUDRSA-N |
| XLogP | 3.49 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |