C26H31N3O3 — CID 122699153
(1S,9R,10S,12S)-16-(cyclopropylmethyl)-4,10-dihydroxy-N-(pyridin-3-ylmethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide (PubChem CID 122699153) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1S,9R,10S,12S)-16-(cyclopropylmethyl)-4,10-dihydroxy-N-(pyridin-3-ylmethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R,10S,12S)-16-(cyclopropylmethyl)-4,10-dihydroxy-N-(pyridin-3-ylmethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 122699153 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (1S,9R,10S,12S)-16-(cyclopropylmethyl)-4,10-dihydroxy-N-(pyridin-3-ylmethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@H]1C[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)[C@]3(O)C1 |
| InChI | InChI=1S/C26H31N3O3/c30-21-6-5-19-10-23-26(32)13-20(24(31)28-15-18-2-1-8-27-14-18)12-25(26,22(19)11-21)7-9-29(23)16-17-3-4-17/h1-2,5-6,8,11,14,17,20,23,30,32H,3-4,7,9-10,12-13,15-16H2,(H,28,31)/t20-,23+,25+,26+/m0/s1 |
| InChIKey | FBNMHXTVRPMBRZ-MGRDPADOSA-N |
| XLogP | 2.52 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |