C27H38N4O4 — CID 122699193
(1S,9R,10S,12S)-16-(cyclopropylmethyl)-10-hydroxy-12-N-(2-morpholin-4-ylethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,12-dicarboxamide (PubChem CID 122699193) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is (1S,9R,10S,12S)-16-(cyclopropylmethyl)-10-hydroxy-12-N-(2-morpholin-4-ylethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,12-dicarboxamide.
| Compound Name | (1S,9R,10S,12S)-16-(cyclopropylmethyl)-10-hydroxy-12-N-(2-morpholin-4-ylethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,12-dicarboxamide |
|---|---|
| PubChem CID | 122699193 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (1S,9R,10S,12S)-16-(cyclopropylmethyl)-10-hydroxy-12-N-(2-morpholin-4-ylethyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4,12-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]1(O)C[C@@H](C(=O)NCCN1CCOCC1)C3 |
| InChI | InChI=1S/C27H38N4O4/c28-24(32)20-4-3-19-14-23-27(34)16-21(25(33)29-6-8-30-9-11-35-12-10-30)15-26(27,22(19)13-20)5-7-31(23)17-18-1-2-18/h3-4,13,18,21,23,34H,1-2,5-12,14-17H2,(H2,28,32)(H,29,33)/t21-,23+,26+,27+/m0/s1 |
| InChIKey | JLWGTOGAAIXHBG-LONWNBDUSA-N |
| XLogP | 0.65 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |