C26H27N3O2S — CID 46245411
(1S,12S,13S)-23-methyl-6-phenyl-9-thia-4,7,23-triazahexacyclo[11.7.3.01,12.03,10.04,8.015,20]tricosa-5,7,15(20),16,18-pentaene-12,18-diol (PubChem CID 46245411) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is (1S,12S,13S)-23-methyl-6-phenyl-9-thia-4,7,23-triazahexacyclo[11.7.3.01,12.03,10.04,8.015,20]tricosa-5,7,15(20),16,18-pentaene-12,18-diol.
| Compound Name | (1S,12S,13S)-23-methyl-6-phenyl-9-thia-4,7,23-triazahexacyclo[11.7.3.01,12.03,10.04,8.015,20]tricosa-5,7,15(20),16,18-pentaene-12,18-diol |
|---|---|
| PubChem CID | 46245411 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (1S,12S,13S)-23-methyl-6-phenyl-9-thia-4,7,23-triazahexacyclo[11.7.3.01,12.03,10.04,8.015,20]tricosa-5,7,15(20),16,18-pentaene-12,18-diol |
| SMILES | CN1CC[C@@]23CC4C(C[C@@]2(O)[C@@H]1Cc1ccc(O)cc13)Sc1nc(-c2ccccc2)cn14 |
| InChI | InChI=1S/C26H27N3O2S/c1-28-10-9-25-13-21-22(32-24-27-20(15-29(21)24)16-5-3-2-4-6-16)14-26(25,31)23(28)11-17-7-8-18(30)12-19(17)25/h2-8,12,15,21-23,30-31H,9-11,13-14H2,1H3/t21?,22?,23-,25-,26+/m0/s1 |
| InChIKey | NVIKTHMIPIOQCT-DYFNSWCYSA-N |
| XLogP | 3.99 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |