C21H33NO5S — CID 158336780
1-(4-hydroxy-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl)pentan-3-one;methanesulfonic acid (PubChem CID 158336780) has the molecular formula C21H33NO5S and a molecular weight of 411.56 g/mol. Its IUPAC name is 1-(4-hydroxy-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl)pentan-3-one;methanesulfonic acid.
| Compound Name | 1-(4-hydroxy-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl)pentan-3-one;methanesulfonic acid |
|---|---|
| PubChem CID | 158336780 |
| Molecular Formula | C21H33NO5S |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(4-hydroxy-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl)pentan-3-one;methanesulfonic acid |
| SMILES | CCC(=O)CCC1(C)C2Cc3ccc(O)cc3C1(C)CCN2C.CS(=O)(=O)O |
| InChI | InChI=1S/C20H29NO2.CH4O3S/c1-5-15(22)8-9-20(3)18-12-14-6-7-16(23)13-17(14)19(20,2)10-11-21(18)4;1-5(2,3)4/h6-7,13,18,23H,5,8-12H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | GQRHHXKQPIEQGM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|