C23H36ClNO2 — CID 90677550
(1R,9R,13S)-10-(cyclopropylmethyl)-13-(3-hydroxy-3-methylbutyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride (PubChem CID 90677550) has the molecular formula C23H36ClNO2 and a molecular weight of 394.00 g/mol. Its IUPAC name is (1R,9R,13S)-10-(cyclopropylmethyl)-13-(3-hydroxy-3-methylbutyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride.
| Compound Name | (1R,9R,13S)-10-(cyclopropylmethyl)-13-(3-hydroxy-3-methylbutyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride |
|---|---|
| PubChem CID | 90677550 |
| Molecular Formula | C23H36ClNO2 |
| Molecular Weight | 394.00 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (1R,9R,13S)-10-(cyclopropylmethyl)-13-(3-hydroxy-3-methylbutyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride |
| SMILES | CC(C)(O)CC[C@]1(C)[C@H]2Cc3ccc(O)cc3[C@@]1(C)CCN2CC1CC1.Cl |
| InChI | InChI=1S/C23H35NO2.ClH/c1-21(2,26)9-10-23(4)20-13-17-7-8-18(25)14-19(17)22(23,3)11-12-24(20)15-16-5-6-16;/h7-8,14,16,20,25-26H,5-6,9-13,15H2,1-4H3;1H/t20-,22-,23-;/m1./s1 |
| InChIKey | SONHWZVVSSROEA-GIICELPUSA-N |
| XLogP | 4.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |