C30H33NO — CID 6602236
(1R,9R,10R)-17-[2-(4-phenylphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 6602236) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is (1R,9R,10R)-17-[2-(4-phenylphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10R)-17-[2-(4-phenylphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 6602236 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (1R,9R,10R)-17-[2-(4-phenylphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CCc1ccc(-c2ccccc2)cc1)CC3 |
| InChI | InChI=1S/C30H33NO/c32-26-14-13-25-20-29-27-8-4-5-16-30(27,28(25)21-26)17-19-31(29)18-15-22-9-11-24(12-10-22)23-6-2-1-3-7-23/h1-3,6-7,9-14,21,27,29,32H,4-5,8,15-20H2/t27-,29+,30+/m0/s1 |
| InChIKey | XIIYJXGKJLBSRJ-GNSPLJBXSA-N |
| XLogP | 6.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |