C29H37NO8 — CID 5486123
(2R,3R)-2,3-dihydroxybutanedioic acid;(1R,9R,10R)-17-[2-(4-methoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 5486123) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;(1R,9R,10R)-17-[2-(4-methoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(1R,9R,10R)-17-[2-(4-methoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 5486123 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(1R,9R,10R)-17-[2-(4-methoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | COc1ccc(CCN2CC[C@]34CCCC[C@H]3[C@H]2Cc2ccc(O)cc24)cc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C25H31NO2.C4H6O6/c1-28-21-9-5-18(6-10-21)11-14-26-15-13-25-12-3-2-4-22(25)24(26)16-19-7-8-20(27)17-23(19)25;5-1(3(7)8)2(6)4(9)10/h5-10,17,22,24,27H,2-4,11-16H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t22-,24+,25+;1-,2-/m01/s1 |
| InChIKey | YYRAOUMHYSDVJT-CZPWWGKQSA-N |
| XLogP | 2.58 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |