C27H35NO4 — CID 3047863
(1R,9S,10R)-17-[2-(3,4,5-trimethoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 3047863) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (1R,9S,10R)-17-[2-(3,4,5-trimethoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9S,10R)-17-[2-(3,4,5-trimethoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 3047863 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (1R,9S,10R)-17-[2-(3,4,5-trimethoxyphenyl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | COc1cc(CCN2CC[C@]34CCCC[C@H]3[C@@H]2Cc2ccc(O)cc24)cc(OC)c1OC |
| InChI | InChI=1S/C27H35NO4/c1-30-24-14-18(15-25(31-2)26(24)32-3)9-12-28-13-11-27-10-5-4-6-21(27)23(28)16-19-7-8-20(29)17-22(19)27/h7-8,14-15,17,21,23,29H,4-6,9-13,16H2,1-3H3/t21-,23-,27+/m0/s1 |
| InChIKey | CYRWLQIBNVIATA-JEYPMZLKSA-N |
| XLogP | 4.72 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |