C25H29NO3 — CID 23307183
(1S,9R,10R)-17-[2-(1,3-benzodioxol-5-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 23307183) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1S,9R,10R)-17-[2-(1,3-benzodioxol-5-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,10R)-17-[2-(1,3-benzodioxol-5-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 23307183 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (1S,9R,10R)-17-[2-(1,3-benzodioxol-5-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | Oc1ccc2c(c1)[C@]13CCCC[C@H]1[C@@H](C2)N(CCc1ccc2c(c1)OCO2)CC3 |
| InChI | InChI=1S/C25H29NO3/c27-19-6-5-18-14-22-20-3-1-2-9-25(20,21(18)15-19)10-12-26(22)11-8-17-4-7-23-24(13-17)29-16-28-23/h4-7,13,15,20,22,27H,1-3,8-12,14,16H2/t20-,22+,25-/m0/s1 |
| InChIKey | JSQINMAOTHBFJL-HOKHCIIBSA-N |
| XLogP | 4.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |