C20H29NO — CID 15177921
(1R,9R,10R)-16-pentyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol (PubChem CID 15177921) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (1R,9R,10R)-16-pentyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10R)-16-pentyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 15177921 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (1R,9R,10R)-16-pentyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
| SMILES | CCCCCN1CC[C@]23CCC[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H29NO/c1-2-3-4-11-21-12-10-20-9-5-6-17(20)19(21)13-15-7-8-16(22)14-18(15)20/h7-8,14,17,19,22H,2-6,9-13H2,1H3/t17-,19+,20+/m0/s1 |
| InChIKey | AJYDINJJSIXHKN-DFQSSKMNSA-N |
| XLogP | 4.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|