C24H38N2O5S — CID 3047705
(1R,9S,10R)-17-[2-(1-methylpiperidin-4-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;sulfuric acid (PubChem CID 3047705) has the molecular formula C24H38N2O5S and a molecular weight of 466.64 g/mol. Its IUPAC name is (1R,9S,10R)-17-[2-(1-methylpiperidin-4-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;sulfuric acid.
| Compound Name | (1R,9S,10R)-17-[2-(1-methylpiperidin-4-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;sulfuric acid |
|---|---|
| PubChem CID | 3047705 |
| Molecular Formula | C24H38N2O5S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (1R,9S,10R)-17-[2-(1-methylpiperidin-4-yl)ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;sulfuric acid |
| SMILES | CN1CCC(CCN2CC[C@]34CCCC[C@H]3[C@@H]2Cc2ccc(O)cc24)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C24H36N2O.H2O4S/c1-25-12-7-18(8-13-25)9-14-26-15-11-24-10-3-2-4-21(24)23(26)16-19-5-6-20(27)17-22(19)24;1-5(2,3)4/h5-6,17-18,21,23,27H,2-4,7-16H2,1H3;(H2,1,2,3,4)/t21-,23-,24+;/m0./s1 |
| InChIKey | VUXURAAEUBMRKC-HQROKSDRSA-N |
| XLogP | 3.53 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|