C20H28BrNO — CID 6917043
(1S,9S,10R)-17-[(E)-but-2-enyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;hydrobromide (PubChem CID 6917043) has the molecular formula C20H28BrNO and a molecular weight of 378.35 g/mol. Its IUPAC name is (1S,9S,10R)-17-[(E)-but-2-enyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;hydrobromide.
| Compound Name | (1S,9S,10R)-17-[(E)-but-2-enyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;hydrobromide |
|---|---|
| PubChem CID | 6917043 |
| Molecular Formula | C20H28BrNO |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (1S,9S,10R)-17-[(E)-but-2-enyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;hydrobromide |
| SMILES | Br.C/C=C/CN1CC[C@@]23CCCC[C@H]2[C@@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H27NO.BrH/c1-2-3-11-21-12-10-20-9-5-4-6-17(20)19(21)13-15-7-8-16(22)14-18(15)20;/h2-3,7-8,14,17,19,22H,4-6,9-13H2,1H3;1H/b3-2+;/t17-,19-,20-;/m0./s1 |
| InChIKey | GIDHETAVKZYKOZ-ZCBRIKAGSA-N |
| XLogP | 4.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|