C32H35NO5 — CID 70582054
oxalic acid;(1R,9R,10R)-4-phenoxy-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 70582054) has the molecular formula C32H35NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is oxalic acid;(1R,9R,10R)-4-phenoxy-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | oxalic acid;(1R,9R,10R)-4-phenoxy-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 70582054 |
| Molecular Formula | C32H35NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | oxalic acid;(1R,9R,10R)-4-phenoxy-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | O=C(O)C(=O)O.c1ccc(CCN2CC[C@]34CCCC[C@H]3[C@H]2Cc2ccc(Oc3ccccc3)cc24)cc1 |
| InChI | InChI=1S/C30H33NO.C2H2O4/c1-3-9-23(10-4-1)16-19-31-20-18-30-17-8-7-13-27(30)29(31)21-24-14-15-26(22-28(24)30)32-25-11-5-2-6-12-25;3-1(4)2(5)6/h1-6,9-12,14-15,22,27,29H,7-8,13,16-21H2;(H,3,4)(H,5,6)/t27-,29+,30+;/m0./s1 |
| InChIKey | UQYRKCVAVPYEDZ-QYVXJREKSA-N |
| XLogP | 5.94 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|