C38H51NO4 — CID 11692786
1-O-benzyl 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate (PubChem CID 11692786) has the molecular formula C38H51NO4 and a molecular weight of 585.83 g/mol. Its IUPAC name is 1-O-benzyl 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate.
| Compound Name | 1-O-benzyl 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate |
|---|---|
| PubChem CID | 11692786 |
| Molecular Formula | C38H51NO4 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | 1-O-benzyl 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] decanedioate |
| SMILES | O=C(CCCCCCCCC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)OCc1ccccc1 |
| InChI | InChI=1S/C38H51NO4/c40-36(42-28-30-13-6-5-7-14-30)18-8-3-1-2-4-9-19-37(41)43-32-21-20-31-25-35-33-17-10-11-22-38(33,34(31)26-32)23-24-39(35)27-29-15-12-16-29/h5-7,13-14,20-21,26,29,33,35H,1-4,8-12,15-19,22-25,27-28H2/t33-,35+,38+/m0/s1 |
| InChIKey | ACGJAWTXSQTUID-LLSVDQBTSA-N |
| XLogP | 8.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|