C51H74N2O4 — CID 46880397
1,9-bis[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]nonane-2,8-diol (PubChem CID 46880397) has the molecular formula C51H74N2O4 and a molecular weight of 779.16 g/mol. Its IUPAC name is 1,9-bis[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]nonane-2,8-diol.
| Compound Name | 1,9-bis[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]nonane-2,8-diol |
|---|---|
| PubChem CID | 46880397 |
| Molecular Formula | C51H74N2O4 |
| Molecular Weight | 779.16 g/mol |
| Exact Mass | 778.56 |
| IUPAC Name | 1,9-bis[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]nonane-2,8-diol |
| SMILES | OC(CCCCCC(O)COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C51H74N2O4/c54-40(34-56-42-20-18-38-28-48-44-16-4-6-22-50(44,46(38)30-42)24-26-52(48)32-36-10-8-11-36)14-2-1-3-15-41(55)35-57-43-21-19-39-29-49-45-17-5-7-23-51(45,47(39)31-43)25-27-53(49)33-37-12-9-13-37/h18-21,30-31,36-37,40-41,44-45,48-49,54-55H,1-17,22-29,32-35H2/t40?,41?,44-,45-,48+,49+,50+,51+/m0/s1 |
| InChIKey | IFHGWDZWXNZOEY-OCHHMNNESA-N |
| XLogP | 9.53 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.16 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|