C21H26F3NO3S — CID 59255003
[17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 59255003) has the molecular formula C21H26F3NO3S and a molecular weight of 429.50 g/mol. Its IUPAC name is [17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59255003 |
| Molecular Formula | C21H26F3NO3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)C13CCCCC1C(C2)N(CC1CC1)CC3)C(F)(F)F |
| InChI | InChI=1S/C21H26F3NO3S/c22-21(23,24)29(26,27)28-16-7-6-15-11-19-17-3-1-2-8-20(17,18(15)12-16)9-10-25(19)13-14-4-5-14/h6-7,12,14,17,19H,1-5,8-11,13H2 |
| InChIKey | QSDFNMSOLKQEDP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|