C21H25F3N2O5S — CID 57412769
[(1R,9R,10R)-17-(cyclopropylmethyl)-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl] trifluoromethanesulfonate (PubChem CID 57412769) has the molecular formula C21H25F3N2O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is [(1R,9R,10R)-17-(cyclopropylmethyl)-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,9R,10R)-17-(cyclopropylmethyl)-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57412769 |
| Molecular Formula | C21H25F3N2O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [(1R,9R,10R)-17-(cyclopropylmethyl)-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl] trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1cc2c(cc1OS(=O)(=O)C(F)(F)F)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C21H25F3N2O5S/c22-21(23,24)32(29,30)31-19-11-16-14(10-18(19)26(27)28)9-17-15-3-1-2-6-20(15,16)7-8-25(17)12-13-4-5-13/h10-11,13,15,17H,1-9,12H2/t15-,17+,20+/m0/s1 |
| InChIKey | HASMCYRSXIFAJN-XAUMDUMWSA-N |
| XLogP | 4.29 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|