C19H24ClN3O3 — CID 122690011
2-chloro-N-[(1R,9R,10R)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]acetamide (PubChem CID 122690011) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-chloro-N-[(1R,9R,10R)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]acetamide.
| Compound Name | 2-chloro-N-[(1R,9R,10R)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 122690011 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-chloro-N-[(1R,9R,10R)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]acetamide |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc([N+](=O)[O-])c(NC(=O)CCl)cc13 |
| InChI | InChI=1S/C19H24ClN3O3/c1-22-7-6-19-5-3-2-4-13(19)16(22)8-12-9-17(23(25)26)15(10-14(12)19)21-18(24)11-20/h9-10,13,16H,2-8,11H2,1H3,(H,21,24)/t13-,16+,19+/m0/s1 |
| InChIKey | YFXVUZXXODYHAO-URKNILKWSA-N |
| XLogP | 3.46 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|