C23H30N4O2 — CID 176819352
N-[(1R,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1-methylimidazole-4-carboxamide (PubChem CID 176819352) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[(1R,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[(1R,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 176819352 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[(1R,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1-methylimidazole-4-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cn(C)cn1)C[C@H]1C3CCCC[C@]23CCN1C |
| InChI | InChI=1S/C23H30N4O2/c1-26-13-19(24-14-26)22(28)25-18-10-15-11-20-16-6-4-5-7-23(16,8-9-27(20)2)17(15)12-21(18)29-3/h10,12-14,16,20H,4-9,11H2,1-3H3,(H,25,28)/t16?,20-,23+/m0/s1 |
| InChIKey | MFNNIWLTFGNIBD-LQERJKSESA-N |
| XLogP | 3.37 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |