C20H30N2O — CID 129195162
(1S,9S,10S)-N-ethyl-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine (PubChem CID 129195162) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,9S,10S)-N-ethyl-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine.
| Compound Name | (1S,9S,10S)-N-ethyl-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 129195162 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (1S,9S,10S)-N-ethyl-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine |
| SMILES | CCNc1cc2c(cc1OC)[C@]13CCCC[C@@H]1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C20H30N2O/c1-4-21-17-11-14-12-18-15-7-5-6-8-20(15,9-10-22(18)2)16(14)13-19(17)23-3/h11,13,15,18,21H,4-10,12H2,1-3H3/t15-,18+,20+/m1/s1 |
| InChIKey | XEXOIGMXESMIPK-BPAFIMBUSA-N |
| XLogP | 3.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |