C24H34N2O3 — CID 169208808
N-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]oxane-4-carboxamide (PubChem CID 169208808) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]oxane-4-carboxamide.
| Compound Name | N-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 169208808 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]oxane-4-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C1CCOCC1)C[C@H]1C3CCCC[C@@]23CCN1C |
| InChI | InChI=1S/C24H34N2O3/c1-26-10-9-24-8-4-3-5-18(24)21(26)14-17-13-20(22(28-2)15-19(17)24)25-23(27)16-6-11-29-12-7-16/h13,15-16,18,21H,3-12,14H2,1-2H3,(H,25,27)/t18?,21-,24-/m0/s1 |
| InChIKey | RYEFZFGAMMBYGU-ZCAYSAGXSA-N |
| XLogP | 3.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |