C29H40N4O3S — CID 134486954
tert-butyl 4-[[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 134486954) has the molecular formula C29H40N4O3S and a molecular weight of 524.73 g/mol. Its IUPAC name is tert-butyl 4-[[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134486954 |
| Molecular Formula | C29H40N4O3S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | tert-butyl 4-[[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc2sc(NC(=O)C4CCN(C(=O)OC(C)(C)C)CC4)nc2cc13 |
| InChI | InChI=1S/C29H40N4O3S/c1-28(2,3)36-27(35)33-12-8-18(9-13-33)25(34)31-26-30-22-17-21-19(16-24(22)37-26)15-23-20-7-5-6-10-29(20,21)11-14-32(23)4/h16-18,20,23H,5-15H2,1-4H3,(H,30,31,34)/t20-,23+,29+/m0/s1 |
| InChIKey | NCLSCLDZWBLRKD-YOLRXJNRSA-N |
| XLogP | 5.57 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |