C22H28N4O2 — CID 175946702
1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]imidazole-4-carboxamide (PubChem CID 175946702) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 175946702 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]imidazole-4-carboxamide |
| SMILES | COc1cc2c(cc1-n1cnc(C(N)=O)c1)C[C@H]1C3CCCC[C@@]23CCN1C |
| InChI | InChI=1S/C22H28N4O2/c1-25-8-7-22-6-4-3-5-15(22)18(25)9-14-10-19(20(28-2)11-16(14)22)26-12-17(21(23)27)24-13-26/h10-13,15,18H,3-9H2,1-2H3,(H2,23,27)/t15?,18-,22-/m0/s1 |
| InChIKey | UQRMPFHCAUXYFS-OYYWJBJPSA-N |
| XLogP | 2.67 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |