C20H25N3O — CID 137359813
(1R,9S,10R)-5-imidazol-1-yl-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 137359813) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R,9S,10R)-5-imidazol-1-yl-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9S,10R)-5-imidazol-1-yl-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 137359813 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (1R,9S,10R)-5-imidazol-1-yl-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@@H]1Cc1cc(-n2ccnc2)c(O)cc13 |
| InChI | InChI=1S/C20H25N3O/c1-22-8-6-20-5-3-2-4-15(20)17(22)10-14-11-18(19(24)12-16(14)20)23-9-7-21-13-23/h7,9,11-13,15,17,24H,2-6,8,10H2,1H3/t15-,17-,20+/m0/s1 |
| InChIKey | HVOYYHHTHWUXDW-RIFZZMRRSA-N |
| XLogP | 3.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |