C22H32N2 — CID 137359929
(1R,9R,10S)-4,17-dimethyl-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 137359929) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (1R,9R,10S)-4,17-dimethyl-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10S)-4,17-dimethyl-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 137359929 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (1R,9R,10S)-4,17-dimethyl-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | Cc1cc2c(cc1N1CCCC1)C[C@@H]1[C@H]3CCCC[C@]23CCN1C |
| InChI | InChI=1S/C22H32N2/c1-16-13-19-17(14-20(16)24-10-5-6-11-24)15-21-18-7-3-4-8-22(18,19)9-12-23(21)2/h13-14,18,21H,3-12,15H2,1-2H3/t18-,21-,22-/m1/s1 |
| InChIKey | LYFCKVKRDCAMLL-STZQEDGTSA-N |
| XLogP | 4.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |