C25H37N3O2 — CID 175946699
1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 175946699) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 175946699 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(c2cc3c(cc2OC)[C@]24CCCCC2[C@H](C3)N(C)CC4)C1 |
| InChI | InChI=1S/C25H37N3O2/c1-26-24(29)17-7-6-11-28(16-17)22-14-18-13-21-19-8-4-5-9-25(19,10-12-27(21)2)20(18)15-23(22)30-3/h14-15,17,19,21H,4-13,16H2,1-3H3,(H,26,29)/t17?,19?,21-,25-/m0/s1 |
| InChIKey | XBFXJGGBVSVJJM-CLNVUGRZSA-N |
| XLogP | 3.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |