C21H31N3O2 — CID 169208823
1-[(1S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1,3-dimethylurea (PubChem CID 169208823) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[(1S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1,3-dimethylurea.
| Compound Name | 1-[(1S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 169208823 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-[(1S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1cc2c(cc1OC)[C@]13CCCCC1C(C2)N(C)CC3 |
| InChI | InChI=1S/C21H31N3O2/c1-22-20(25)24(3)18-12-14-11-17-15-7-5-6-8-21(15,9-10-23(17)2)16(14)13-19(18)26-4/h12-13,15,17H,5-11H2,1-4H3,(H,22,25)/t15?,17?,21-/m0/s1 |
| InChIKey | IIWKQXVJRNQHDS-GRXDXKALSA-N |
| XLogP | 3.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |